C14H18ClNO5 — CID 139561746
1-O-amino 3-O-tert-butyl 2-[(2-chloro-4-hydroxyphenyl)methyl]propanedioate (PubChem CID 139561746) has the molecular formula C14H18ClNO5 and a molecular weight of 315.75 g/mol. Its IUPAC name is 1-O-amino 3-O-tert-butyl 2-[(2-chloro-4-hydroxyphenyl)methyl]propanedioate.
| Compound Name | 1-O-amino 3-O-tert-butyl 2-[(2-chloro-4-hydroxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 139561746 |
| Molecular Formula | C14H18ClNO5 |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-O-amino 3-O-tert-butyl 2-[(2-chloro-4-hydroxyphenyl)methyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccc(O)cc1Cl)C(=O)ON |
| InChI | InChI=1S/C14H18ClNO5/c1-14(2,3)20-12(18)10(13(19)21-16)6-8-4-5-9(17)7-11(8)15/h4-5,7,10,17H,6,16H2,1-3H3 |
| InChIKey | GKSYHGZTEVHLLP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|