C14H21ClN2O3 — CID 139568859
tert-butyl N-[(2S)-1-amino-3-(2-chloro-4-hydroxyphenyl)propan-2-yl]carbamate (PubChem CID 139568859) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-amino-3-(2-chloro-4-hydroxyphenyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-amino-3-(2-chloro-4-hydroxyphenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 139568859 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | tert-butyl N-[(2S)-1-amino-3-(2-chloro-4-hydroxyphenyl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CN)Cc1ccc(O)cc1Cl |
| InChI | InChI=1S/C14H21ClN2O3/c1-14(2,3)20-13(19)17-10(8-16)6-9-4-5-11(18)7-12(9)15/h4-5,7,10,18H,6,8,16H2,1-3H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | YNYXJJMHXPZFDD-JTQLQIEISA-N |
| XLogP | 2.44 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |