C23H37F2N3O7 — CID 139563827
1-O-tert-butyl 2-O-[2-[(2S,3R,5S)-5-carbamoyl-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]ethyl] (2S,4R,5S)-4-fluoro-5-methylpyrrolidine-1,2-dicarboxylate (PubChem CID 139563827) has the molecular formula C23H37F2N3O7 and a molecular weight of 505.56 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[2-[(2S,3R,5S)-5-carbamoyl-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]ethyl] (2S,4R,5S)-4-fluoro-5-methylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[2-[(2S,3R,5S)-5-carbamoyl-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]ethyl] (2S,4R,5S)-4-fluoro-5-methylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139563827 |
| Molecular Formula | C23H37F2N3O7 |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 1-O-tert-butyl 2-O-[2-[(2S,3R,5S)-5-carbamoyl-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]ethyl] (2S,4R,5S)-4-fluoro-5-methylpyrrolidine-1,2-dicarboxylate |
| SMILES | C[C@H]1[C@H](F)C[C@@H](C(=O)OCC[C@H]2[C@H](F)C[C@@H](C(N)=O)N2C(=O)OC(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37F2N3O7/c1-12-13(24)10-17(27(12)20(31)34-22(2,3)4)19(30)33-9-8-15-14(25)11-16(18(26)29)28(15)21(32)35-23(5,6)7/h12-17H,8-11H2,1-7H3,(H2,26,29)/t12-,13+,14+,15-,16-,17-/m0/s1 |
| InChIKey | ITOAGZBTZFHJOT-VBYGDGQVSA-N |
| XLogP | 2.86 |
| TPSA | 128.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|