C29H51N3O7 — CID 14819188
tert-butyl (2S)-1-[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2-oxo-5-pentyloxolan-3-yl)amino]hexanoyl]pyrrolidine-2-carboxylate (PubChem CID 14819188) has the molecular formula C29H51N3O7 and a molecular weight of 553.74 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2-oxo-5-pentyloxolan-3-yl)amino]hexanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2-oxo-5-pentyloxolan-3-yl)amino]hexanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 14819188 |
| Molecular Formula | C29H51N3O7 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.37 |
| IUPAC Name | tert-butyl (2S)-1-[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2-oxo-5-pentyloxolan-3-yl)amino]hexanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCC1CC(N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)N2CCC[C@H]2C(=O)OC(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C29H51N3O7/c1-8-9-10-14-20-19-22(25(34)37-20)31-21(15-11-12-17-30-27(36)39-29(5,6)7)24(33)32-18-13-16-23(32)26(35)38-28(2,3)4/h20-23,31H,8-19H2,1-7H3,(H,30,36)/t20?,21-,22?,23-/m0/s1 |
| InChIKey | RIHWONUNXYCQOL-ZWDXQAFOSA-N |
| XLogP | 4.24 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|