C15H13F3N4 — CID 139564629
2-ethyl-4-methylidene-3-(1H-pyrazol-4-yl)-5-(trifluoromethyl)quinazoline (PubChem CID 139564629) has the molecular formula C15H13F3N4 and a molecular weight of 306.29 g/mol. Its IUPAC name is 2-ethyl-4-methylidene-3-(1H-pyrazol-4-yl)-5-(trifluoromethyl)quinazoline.
| Compound Name | 2-ethyl-4-methylidene-3-(1H-pyrazol-4-yl)-5-(trifluoromethyl)quinazoline |
|---|---|
| PubChem CID | 139564629 |
| Molecular Formula | C15H13F3N4 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-ethyl-4-methylidene-3-(1H-pyrazol-4-yl)-5-(trifluoromethyl)quinazoline |
| SMILES | C=C1c2c(cccc2C(F)(F)F)N=C(CC)N1c1cn[nH]c1 |
| InChI | InChI=1S/C15H13F3N4/c1-3-13-21-12-6-4-5-11(15(16,17)18)14(12)9(2)22(13)10-7-19-20-8-10/h4-8H,2-3H2,1H3,(H,19,20) |
| InChIKey | OBTSNOIGPMWOJE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 44.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |