C22H19F3N6O3 — CID 139564864
4-[6-[hydroxy-[[(1R)-1-[3-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]-1,2-oxazol-5-yl]ethyl]amino]methyl]pyrimidin-4-yl]but-3-yn-1-ol (PubChem CID 139564864) has the molecular formula C22H19F3N6O3 and a molecular weight of 472.43 g/mol. Its IUPAC name is 4-[6-[hydroxy-[[(1R)-1-[3-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]-1,2-oxazol-5-yl]ethyl]amino]methyl]pyrimidin-4-yl]but-3-yn-1-ol.
| Compound Name | 4-[6-[hydroxy-[[(1R)-1-[3-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]-1,2-oxazol-5-yl]ethyl]amino]methyl]pyrimidin-4-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 139564864 |
| Molecular Formula | C22H19F3N6O3 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 4-[6-[hydroxy-[[(1R)-1-[3-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]-1,2-oxazol-5-yl]ethyl]amino]methyl]pyrimidin-4-yl]but-3-yn-1-ol |
| SMILES | C[C@@H](NC(O)c1cc(C#CCCO)ncn1)c1cc(-c2nc3ccc(C(F)(F)F)cc3[nH]2)no1 |
| InChI | InChI=1S/C22H19F3N6O3/c1-12(28-21(33)18-9-14(26-11-27-18)4-2-3-7-32)19-10-17(31-34-19)20-29-15-6-5-13(22(23,24)25)8-16(15)30-20/h5-6,8-12,21,28,32-33H,3,7H2,1H3,(H,29,30)/t12-,21?/m1/s1 |
| InChIKey | KZRXXFKRALBNNN-FXADVQPWSA-N |
| XLogP | 3.10 |
| TPSA | 132.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|