C15H19N3O2S — CID 139564934
N-[1-(5-acetyl-1,3-thiazol-2-yl)ethyl]-2-ethenylimino-4-methylpent-3-enamide (PubChem CID 139564934) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-[1-(5-acetyl-1,3-thiazol-2-yl)ethyl]-2-ethenylimino-4-methylpent-3-enamide.
| Compound Name | N-[1-(5-acetyl-1,3-thiazol-2-yl)ethyl]-2-ethenylimino-4-methylpent-3-enamide |
|---|---|
| PubChem CID | 139564934 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[1-(5-acetyl-1,3-thiazol-2-yl)ethyl]-2-ethenylimino-4-methylpent-3-enamide |
| SMILES | C=C/N=C(\C=C(C)C)C(=O)NC(C)c1ncc(C(C)=O)s1 |
| InChI | InChI=1S/C15H19N3O2S/c1-6-16-12(7-9(2)3)14(20)18-10(4)15-17-8-13(21-15)11(5)19/h6-8,10H,1H2,2-5H3,(H,18,20)/b16-12+ |
| InChIKey | MEXFXUOYUPPFGT-FOWTUZBSSA-N |
| XLogP | 3.07 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|