C10H14N8O2S3 — CID 139565239
[5-[2-[2-[5-(carbamoylamino)-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]urea (PubChem CID 139565239) has the molecular formula C10H14N8O2S3 and a molecular weight of 374.48 g/mol. Its IUPAC name is [5-[2-[2-[5-(carbamoylamino)-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | [5-[2-[2-[5-(carbamoylamino)-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 139565239 |
| Molecular Formula | C10H14N8O2S3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | [5-[2-[2-[5-(carbamoylamino)-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]urea |
| SMILES | NC(=O)Nc1nnc(CCSCCc2nnc(NC(N)=O)s2)s1 |
| InChI | InChI=1S/C10H14N8O2S3/c11-7(19)13-9-17-15-5(22-9)1-3-21-4-2-6-16-18-10(23-6)14-8(12)20/h1-4H2,(H3,11,13,17,19)(H3,12,14,18,20) |
| InChIKey | CTBLRJKKUVEGFS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 161.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|