C22H38N8O2S3 — CID 123868297
3-amino-N-[5-[2-[2-[5-[(3-amino-2,4-dimethylpentanoyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-2,4-dimethylpentanamide (PubChem CID 123868297) has the molecular formula C22H38N8O2S3 and a molecular weight of 542.80 g/mol. Its IUPAC name is 3-amino-N-[5-[2-[2-[5-[(3-amino-2,4-dimethylpentanoyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-2,4-dimethylpentanamide.
| Compound Name | 3-amino-N-[5-[2-[2-[5-[(3-amino-2,4-dimethylpentanoyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-2,4-dimethylpentanamide |
|---|---|
| PubChem CID | 123868297 |
| Molecular Formula | C22H38N8O2S3 |
| Molecular Weight | 542.80 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 3-amino-N-[5-[2-[2-[5-[(3-amino-2,4-dimethylpentanoyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-2,4-dimethylpentanamide |
| SMILES | CC(C)C(N)C(C)C(=O)Nc1nnc(CCSCCc2nnc(NC(=O)C(C)C(N)C(C)C)s2)s1 |
| InChI | InChI=1S/C22H38N8O2S3/c1-11(2)17(23)13(5)19(31)25-21-29-27-15(34-21)7-9-33-10-8-16-28-30-22(35-16)26-20(32)14(6)18(24)12(3)4/h11-14,17-18H,7-10,23-24H2,1-6H3,(H,25,29,31)(H,26,30,32) |
| InChIKey | BMCGWBUGEYDPSW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 161.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.80 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|