C30H25N3O — CID 139566045
8-[4-amino-2-(3,4-dihydrocarbazol-9-yl)phenyl]-1,2-dihydrodibenzofuran-2-amine (PubChem CID 139566045) has the molecular formula C30H25N3O and a molecular weight of 443.55 g/mol. Its IUPAC name is 8-[4-amino-2-(3,4-dihydrocarbazol-9-yl)phenyl]-1,2-dihydrodibenzofuran-2-amine.
| Compound Name | 8-[4-amino-2-(3,4-dihydrocarbazol-9-yl)phenyl]-1,2-dihydrodibenzofuran-2-amine |
|---|---|
| PubChem CID | 139566045 |
| Molecular Formula | C30H25N3O |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 8-[4-amino-2-(3,4-dihydrocarbazol-9-yl)phenyl]-1,2-dihydrodibenzofuran-2-amine |
| SMILES | Nc1ccc(-c2ccc3oc4c(c3c2)CC(N)C=C4)c(-n2c3c(c4ccccc42)CCC=C3)c1 |
| InChI | InChI=1S/C30H25N3O/c31-19-11-14-30-25(16-19)24-15-18(9-13-29(24)34-30)21-12-10-20(32)17-28(21)33-26-7-3-1-5-22(26)23-6-2-4-8-27(23)33/h1,3-5,7-15,17,19H,2,6,16,31-32H2 |
| InChIKey | VFJNCFGTBZYKSY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|