C51H32N4O2 — CID 174291367
9-[3-[3-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]phenyl]phenyl]-3,4-dihydrocarbazole (PubChem CID 174291367) has the molecular formula C51H32N4O2 and a molecular weight of 732.84 g/mol. Its IUPAC name is 9-[3-[3-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]phenyl]phenyl]-3,4-dihydrocarbazole.
| Compound Name | 9-[3-[3-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]phenyl]phenyl]-3,4-dihydrocarbazole |
|---|---|
| PubChem CID | 174291367 |
| Molecular Formula | C51H32N4O2 |
| Molecular Weight | 732.84 g/mol |
| Exact Mass | 732.25 |
| IUPAC Name | 9-[3-[3-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]phenyl]phenyl]-3,4-dihydrocarbazole |
| SMILES | C1=Cc2c(c3ccccc3n2-c2cccc(-c3cccc(-c4nc(-c5ccc6c(c5)oc5ccccc56)nc(-c5ccc6c(c5)oc5ccccc56)n4)c3)c2)CC1 |
| InChI | InChI=1S/C51H32N4O2/c1-5-19-43-37(15-1)38-16-2-6-20-44(38)55(43)36-14-10-12-32(28-36)31-11-9-13-33(27-31)49-52-50(34-23-25-41-39-17-3-7-21-45(39)56-47(41)29-34)54-51(53-49)35-24-26-42-40-18-4-8-22-46(40)57-48(42)30-35/h1,3-15,17-30H,2,16H2 |
| InChIKey | XAZQQLLXJTVZHR-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.84 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |