C21H16N4 — CID 175358566
9-[3-(1,3,5-triazin-2-yl)phenyl]-3,4-dihydrocarbazole (PubChem CID 175358566) has the molecular formula C21H16N4 and a molecular weight of 324.39 g/mol. Its IUPAC name is 9-[3-(1,3,5-triazin-2-yl)phenyl]-3,4-dihydrocarbazole.
| Compound Name | 9-[3-(1,3,5-triazin-2-yl)phenyl]-3,4-dihydrocarbazole |
|---|---|
| PubChem CID | 175358566 |
| Molecular Formula | C21H16N4 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 9-[3-(1,3,5-triazin-2-yl)phenyl]-3,4-dihydrocarbazole |
| SMILES | C1=Cc2c(c3ccccc3n2-c2cccc(-c3ncncn3)c2)CC1 |
| InChI | InChI=1S/C21H16N4/c1-3-10-19-17(8-1)18-9-2-4-11-20(18)25(19)16-7-5-6-15(12-16)21-23-13-22-14-24-21/h1,3-8,10-14H,2,9H2 |
| InChIKey | WYLPXORGFDLLTI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |