C14H27FN2 — CID 139566303
N'-[(Z)-2-ethenyl-3-fluoropent-2-enyl]-N,N'-diethyl-N-methylethane-1,2-diamine (PubChem CID 139566303) has the molecular formula C14H27FN2 and a molecular weight of 242.38 g/mol. Its IUPAC name is N'-[(Z)-2-ethenyl-3-fluoropent-2-enyl]-N,N'-diethyl-N-methylethane-1,2-diamine.
| Compound Name | N'-[(Z)-2-ethenyl-3-fluoropent-2-enyl]-N,N'-diethyl-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 139566303 |
| Molecular Formula | C14H27FN2 |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | N'-[(Z)-2-ethenyl-3-fluoropent-2-enyl]-N,N'-diethyl-N-methylethane-1,2-diamine |
| SMILES | C=C/C(CN(CC)CCN(C)CC)=C(/F)CC |
| InChI | InChI=1S/C14H27FN2/c1-6-13(14(15)7-2)12-17(9-4)11-10-16(5)8-3/h6H,1,7-12H2,2-5H3/b14-13- |
| InChIKey | WZMGXDYDUJAPFU-YPKPFQOOSA-N |
| XLogP | 3.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|