C11H25N2O+ — CID 139568548
4-(2,2-dimethylpropyl)-1-methoxy-1-methylpiperazin-1-ium (PubChem CID 139568548) has the molecular formula C11H25N2O+ and a molecular weight of 201.33 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-1-methoxy-1-methylpiperazin-1-ium.
| Compound Name | 4-(2,2-dimethylpropyl)-1-methoxy-1-methylpiperazin-1-ium |
|---|---|
| PubChem CID | 139568548 |
| Molecular Formula | C11H25N2O+ |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.20 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-1-methoxy-1-methylpiperazin-1-ium |
| SMILES | CO[N+]1(C)CCN(CC(C)(C)C)CC1 |
| InChI | InChI=1S/C11H25N2O/c1-11(2,3)10-12-6-8-13(4,14-5)9-7-12/h6-10H2,1-5H3/q+1 |
| InChIKey | RTEPJYGYQQUAAY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|