C20H43NO3 — CID 163709399
1-(2,2-dimethylpropyl)piperidine;1-[2-(2-methoxyethoxy)ethoxy]-2,2-dimethylpropane (PubChem CID 163709399) has the molecular formula C20H43NO3 and a molecular weight of 345.57 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)piperidine;1-[2-(2-methoxyethoxy)ethoxy]-2,2-dimethylpropane.
| Compound Name | 1-(2,2-dimethylpropyl)piperidine;1-[2-(2-methoxyethoxy)ethoxy]-2,2-dimethylpropane |
|---|---|
| PubChem CID | 163709399 |
| Molecular Formula | C20H43NO3 |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.32 |
| IUPAC Name | 1-(2,2-dimethylpropyl)piperidine;1-[2-(2-methoxyethoxy)ethoxy]-2,2-dimethylpropane |
| SMILES | CC(C)(C)CN1CCCCC1.COCCOCCOCC(C)(C)C |
| InChI | InChI=1S/C10H21N.C10H22O3/c1-10(2,3)9-11-7-5-4-6-8-11;1-10(2,3)9-13-8-7-12-6-5-11-4/h4-9H2,1-3H3;5-9H2,1-4H3 |
| InChIKey | KHVXGDRDUHIJBD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|