C17H15N5O2 — CID 139568940
2-[(2S)-2-amino-3-(1H-pyrazolo[5,4-b]pyridin-5-yl)propyl]isoindole-1,3-dione (PubChem CID 139568940) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-[(2S)-2-amino-3-(1H-pyrazolo[5,4-b]pyridin-5-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-2-amino-3-(1H-pyrazolo[5,4-b]pyridin-5-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139568940 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-[(2S)-2-amino-3-(1H-pyrazolo[5,4-b]pyridin-5-yl)propyl]isoindole-1,3-dione |
| SMILES | N[C@@H](Cc1cnc2[nH]ncc2c1)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H15N5O2/c18-12(6-10-5-11-8-20-21-15(11)19-7-10)9-22-16(23)13-3-1-2-4-14(13)17(22)24/h1-5,7-8,12H,6,9,18H2,(H,19,20,21)/t12-/m0/s1 |
| InChIKey | NITIQCAUQHSCRG-LBPRGKRZSA-N |
| XLogP | 1.12 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|