C10H13BrN2 — CID 139569108
4-(4-bromophenyl)but-1-ene-2,3-diamine (PubChem CID 139569108) has the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. Its IUPAC name is 4-(4-bromophenyl)but-1-ene-2,3-diamine.
| Compound Name | 4-(4-bromophenyl)but-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 139569108 |
| Molecular Formula | C10H13BrN2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 4-(4-bromophenyl)but-1-ene-2,3-diamine |
| SMILES | C=C(N)C(N)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C10H13BrN2/c1-7(12)10(13)6-8-2-4-9(11)5-3-8/h2-5,10H,1,6,12-13H2 |
| InChIKey | PJBFNRZHYUOWPX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |