C17H18ClN3O2 — CID 139571625
2-(4-chlorophenoxy)-N-[5,6-dimethyl-4-(methyliminomethyl)-3-pyridinyl]acetamide (PubChem CID 139571625) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[5,6-dimethyl-4-(methyliminomethyl)-3-pyridinyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[5,6-dimethyl-4-(methyliminomethyl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 139571625 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[5,6-dimethyl-4-(methyliminomethyl)-3-pyridinyl]acetamide |
| SMILES | C/N=C/c1c(NC(=O)COc2ccc(Cl)cc2)cnc(C)c1C |
| InChI | InChI=1S/C17H18ClN3O2/c1-11-12(2)20-9-16(15(11)8-19-3)21-17(22)10-23-14-6-4-13(18)5-7-14/h4-9H,10H2,1-3H3,(H,21,22)/b19-8+ |
| InChIKey | VOTIAVWVBGLXCZ-UFWORHAWSA-N |
| XLogP | 3.42 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|