C23H12Cl2N2 — CID 139573003
4-(3,8-dichlorobenzo[b]carbazol-5-yl)benzonitrile (PubChem CID 139573003) has the molecular formula C23H12Cl2N2 and a molecular weight of 387.27 g/mol. Its IUPAC name is 4-(3,8-dichlorobenzo[b]carbazol-5-yl)benzonitrile.
| Compound Name | 4-(3,8-dichlorobenzo[b]carbazol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 139573003 |
| Molecular Formula | C23H12Cl2N2 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 4-(3,8-dichlorobenzo[b]carbazol-5-yl)benzonitrile |
| SMILES | N#Cc1ccc(-n2c3cc(Cl)ccc3c3cc4ccc(Cl)cc4cc32)cc1 |
| InChI | InChI=1S/C23H12Cl2N2/c24-17-4-3-15-10-21-20-8-5-18(25)12-23(20)27(22(21)11-16(15)9-17)19-6-1-14(13-26)2-7-19/h1-12H |
| InChIKey | MEDCOEWGYWIPKH-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |