C30H30N4O2S2 — CID 139573067
N-[2-methyl-3-[2-methyl-3-(4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carbonylamino)phenyl]phenyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxamide (PubChem CID 139573067) has the molecular formula C30H30N4O2S2 and a molecular weight of 542.73 g/mol. Its IUPAC name is N-[2-methyl-3-[2-methyl-3-(4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carbonylamino)phenyl]phenyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[2-methyl-3-[2-methyl-3-(4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carbonylamino)phenyl]phenyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139573067 |
| Molecular Formula | C30H30N4O2S2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | N-[2-methyl-3-[2-methyl-3-(4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carbonylamino)phenyl]phenyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2cc3c(s2)CNCC3)cccc1-c1cccc(NC(=O)c2cc3c(s2)CNCC3)c1C |
| InChI | InChI=1S/C30H30N4O2S2/c1-17-21(5-3-7-23(17)33-29(35)25-13-19-9-11-31-15-27(19)37-25)22-6-4-8-24(18(22)2)34-30(36)26-14-20-10-12-32-16-28(20)38-26/h3-8,13-14,31-32H,9-12,15-16H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | HZCATXZSFTUZBE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |