C13H17FO2S — CID 139575685
[4-fluoro-6-(4-methylphenyl)sulfanyloxan-2-yl]methanol (PubChem CID 139575685) has the molecular formula C13H17FO2S and a molecular weight of 256.34 g/mol. Its IUPAC name is [4-fluoro-6-(4-methylphenyl)sulfanyloxan-2-yl]methanol.
| Compound Name | [4-fluoro-6-(4-methylphenyl)sulfanyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 139575685 |
| Molecular Formula | C13H17FO2S |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | [4-fluoro-6-(4-methylphenyl)sulfanyloxan-2-yl]methanol |
| SMILES | Cc1ccc(SC2CC(F)CC(CO)O2)cc1 |
| InChI | InChI=1S/C13H17FO2S/c1-9-2-4-12(5-3-9)17-13-7-10(14)6-11(8-15)16-13/h2-5,10-11,13,15H,6-8H2,1H3 |
| InChIKey | GJWWNYWRIZWBLH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |