C17H19BrF2O4 — CID 139576612
ethyl 2-[2-[(3Z,5Z)-5-bromo-3-fluoro-6-hydroxyhepta-3,5-dien-2-yl]oxy-4-fluorophenyl]acetate (PubChem CID 139576612) has the molecular formula C17H19BrF2O4 and a molecular weight of 405.24 g/mol. Its IUPAC name is ethyl 2-[2-[(3Z,5Z)-5-bromo-3-fluoro-6-hydroxyhepta-3,5-dien-2-yl]oxy-4-fluorophenyl]acetate.
| Compound Name | ethyl 2-[2-[(3Z,5Z)-5-bromo-3-fluoro-6-hydroxyhepta-3,5-dien-2-yl]oxy-4-fluorophenyl]acetate |
|---|---|
| PubChem CID | 139576612 |
| Molecular Formula | C17H19BrF2O4 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | ethyl 2-[2-[(3Z,5Z)-5-bromo-3-fluoro-6-hydroxyhepta-3,5-dien-2-yl]oxy-4-fluorophenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(F)cc1OC(C)/C(F)=C/C(Br)=C(\C)O |
| InChI | InChI=1S/C17H19BrF2O4/c1-4-23-17(22)7-12-5-6-13(19)8-16(12)24-11(3)15(20)9-14(18)10(2)21/h5-6,8-9,11,21H,4,7H2,1-3H3/b14-10-,15-9- |
| InChIKey | WQHYDCJINHFHGB-CEUHLDMKSA-N |
| XLogP | 4.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|