C16H17BrF2O4 — CID 166942886
ethyl 2-[2-[(1Z,3Z)-3-bromo-1-fluoro-4-hydroxyhexa-1,3-dienoxy]-4-fluorophenyl]acetate (PubChem CID 166942886) has the molecular formula C16H17BrF2O4 and a molecular weight of 391.21 g/mol. Its IUPAC name is ethyl 2-[2-[(1Z,3Z)-3-bromo-1-fluoro-4-hydroxyhexa-1,3-dienoxy]-4-fluorophenyl]acetate.
| Compound Name | ethyl 2-[2-[(1Z,3Z)-3-bromo-1-fluoro-4-hydroxyhexa-1,3-dienoxy]-4-fluorophenyl]acetate |
|---|---|
| PubChem CID | 166942886 |
| Molecular Formula | C16H17BrF2O4 |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | ethyl 2-[2-[(1Z,3Z)-3-bromo-1-fluoro-4-hydroxyhexa-1,3-dienoxy]-4-fluorophenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(F)cc1O/C(F)=C/C(Br)=C(/O)CC |
| InChI | InChI=1S/C16H17BrF2O4/c1-3-13(20)12(17)9-15(19)23-14-8-11(18)6-5-10(14)7-16(21)22-4-2/h5-6,8-9,20H,3-4,7H2,1-2H3/b13-12-,15-9+ |
| InChIKey | KTUFRJDYXVSHMC-VAXYWCJJSA-N |
| XLogP | 4.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|