C19H23NO — CID 139578462
(2R,3S)-1-benzyl-2-methyl-3-(phenylmethoxymethyl)azetidine (PubChem CID 139578462) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is (2R,3S)-1-benzyl-2-methyl-3-(phenylmethoxymethyl)azetidine.
| Compound Name | (2R,3S)-1-benzyl-2-methyl-3-(phenylmethoxymethyl)azetidine |
|---|---|
| PubChem CID | 139578462 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (2R,3S)-1-benzyl-2-methyl-3-(phenylmethoxymethyl)azetidine |
| SMILES | C[C@@H]1[C@@H](COCc2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C19H23NO/c1-16-19(15-21-14-18-10-6-3-7-11-18)13-20(16)12-17-8-4-2-5-9-17/h2-11,16,19H,12-15H2,1H3/t16-,19-/m1/s1 |
| InChIKey | WFAUSYBFJHGLHE-VQIMIIECSA-N |
| XLogP | 3.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |