C35H38ClFN4O7 — CID 139579379
ethyl 2-[2-[2-[(E)-5-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]piperazin-1-yl]-5-oxopent-3-enoxy]ethoxy]ethoxy]acetate (PubChem CID 139579379) has the molecular formula C35H38ClFN4O7 and a molecular weight of 681.16 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(E)-5-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]piperazin-1-yl]-5-oxopent-3-enoxy]ethoxy]ethoxy]acetate.
| Compound Name | ethyl 2-[2-[2-[(E)-5-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]piperazin-1-yl]-5-oxopent-3-enoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 139579379 |
| Molecular Formula | C35H38ClFN4O7 |
| Molecular Weight | 681.16 g/mol |
| Exact Mass | 680.24 |
| IUPAC Name | ethyl 2-[2-[2-[(E)-5-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]piperazin-1-yl]-5-oxopent-3-enoxy]ethoxy]ethoxy]acetate |
| SMILES | CCOC(=O)COCCOCCOCC/C=C/C(=O)N1CCN(c2ncnc3c(F)c(-c4cc(O)cc5ccccc45)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C35H38ClFN4O7/c1-2-48-31(44)22-47-18-17-46-16-15-45-14-6-5-9-30(43)40-10-12-41(13-11-40)35-28-21-29(36)32(33(37)34(28)38-23-39-35)27-20-25(42)19-24-7-3-4-8-26(24)27/h3-5,7-9,19-21,23,42H,2,6,10-18,22H2,1H3/b9-5+ |
| InChIKey | CAJAHYQINWCYOT-WEVVVXLNSA-N |
| XLogP | 5.16 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.16 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|