C14H18BrF2NO3 — CID 139579729
ethyl 2-[5-bromo-3-(difluoromethyl)-2-oxo-1-pyridinyl]-4-methylpentanoate (PubChem CID 139579729) has the molecular formula C14H18BrF2NO3 and a molecular weight of 366.20 g/mol. Its IUPAC name is ethyl 2-[5-bromo-3-(difluoromethyl)-2-oxo-1-pyridinyl]-4-methylpentanoate.
| Compound Name | ethyl 2-[5-bromo-3-(difluoromethyl)-2-oxo-1-pyridinyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 139579729 |
| Molecular Formula | C14H18BrF2NO3 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | ethyl 2-[5-bromo-3-(difluoromethyl)-2-oxo-1-pyridinyl]-4-methylpentanoate |
| SMILES | CCOC(=O)C(CC(C)C)n1cc(Br)cc(C(F)F)c1=O |
| InChI | InChI=1S/C14H18BrF2NO3/c1-4-21-14(20)11(5-8(2)3)18-7-9(15)6-10(12(16)17)13(18)19/h6-8,11-12H,4-5H2,1-3H3 |
| InChIKey | QOPDGLMPQBTRGB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |