C17H23F2NO3 — CID 139579869
ethyl 2-[3-(difluoromethyl)-2-oxo-5-prop-2-enyl-1-pyridinyl]-4-methylpentanoate (PubChem CID 139579869) has the molecular formula C17H23F2NO3 and a molecular weight of 327.37 g/mol. Its IUPAC name is ethyl 2-[3-(difluoromethyl)-2-oxo-5-prop-2-enyl-1-pyridinyl]-4-methylpentanoate.
| Compound Name | ethyl 2-[3-(difluoromethyl)-2-oxo-5-prop-2-enyl-1-pyridinyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 139579869 |
| Molecular Formula | C17H23F2NO3 |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | ethyl 2-[3-(difluoromethyl)-2-oxo-5-prop-2-enyl-1-pyridinyl]-4-methylpentanoate |
| SMILES | C=CCc1cc(C(F)F)c(=O)n(C(CC(C)C)C(=O)OCC)c1 |
| InChI | InChI=1S/C17H23F2NO3/c1-5-7-12-9-13(15(18)19)16(21)20(10-12)14(8-11(3)4)17(22)23-6-2/h5,9-11,14-15H,1,6-8H2,2-4H3 |
| InChIKey | DDTCDGBXPRYIHS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|