C21H17FN6O2S — CID 139580294
7-(azidomethyl)-5-fluoro-2-(2-methoxy-7-methylquinoxalin-5-yl)-7-methyl-8H-furo[2,3-g][1,3]benzothiazole (PubChem CID 139580294) has the molecular formula C21H17FN6O2S and a molecular weight of 436.47 g/mol. Its IUPAC name is 7-(azidomethyl)-5-fluoro-2-(2-methoxy-7-methylquinoxalin-5-yl)-7-methyl-8H-furo[2,3-g][1,3]benzothiazole.
| Compound Name | 7-(azidomethyl)-5-fluoro-2-(2-methoxy-7-methylquinoxalin-5-yl)-7-methyl-8H-furo[2,3-g][1,3]benzothiazole |
|---|---|
| PubChem CID | 139580294 |
| Molecular Formula | C21H17FN6O2S |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 7-(azidomethyl)-5-fluoro-2-(2-methoxy-7-methylquinoxalin-5-yl)-7-methyl-8H-furo[2,3-g][1,3]benzothiazole |
| SMILES | COc1cnc2c(-c3nc4cc(F)c5c(c4s3)CC(C)(CN=[N+]=[N-])O5)cc(C)cc2n1 |
| InChI | InChI=1S/C21H17FN6O2S/c1-10-4-11(17-14(5-10)26-16(29-3)8-24-17)20-27-15-6-13(22)18-12(19(15)31-20)7-21(2,30-18)9-25-28-23/h4-6,8H,7,9H2,1-3H3 |
| InChIKey | DVUZBFWQLYSEJV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 105.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|