C26H30F3N5O4 — CID 139580572
(2S,3R)-3-[(2-amino-4-pyridinyl)methyl]-1-N-(1-cyclohexyl-2,2,2-trifluoroethyl)-2-N-(4-methoxyphenyl)-4-oxoazetidine-1,2-dicarboxamide (PubChem CID 139580572) has the molecular formula C26H30F3N5O4 and a molecular weight of 533.55 g/mol. Its IUPAC name is (2S,3R)-3-[(2-amino-4-pyridinyl)methyl]-1-N-(1-cyclohexyl-2,2,2-trifluoroethyl)-2-N-(4-methoxyphenyl)-4-oxoazetidine-1,2-dicarboxamide.
| Compound Name | (2S,3R)-3-[(2-amino-4-pyridinyl)methyl]-1-N-(1-cyclohexyl-2,2,2-trifluoroethyl)-2-N-(4-methoxyphenyl)-4-oxoazetidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 139580572 |
| Molecular Formula | C26H30F3N5O4 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | (2S,3R)-3-[(2-amino-4-pyridinyl)methyl]-1-N-(1-cyclohexyl-2,2,2-trifluoroethyl)-2-N-(4-methoxyphenyl)-4-oxoazetidine-1,2-dicarboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2[C@@H](Cc3ccnc(N)c3)C(=O)N2C(=O)NC(C2CCCCC2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H30F3N5O4/c1-38-18-9-7-17(8-10-18)32-23(35)21-19(13-15-11-12-31-20(30)14-15)24(36)34(21)25(37)33-22(26(27,28)29)16-5-3-2-4-6-16/h7-12,14,16,19,21-22H,2-6,13H2,1H3,(H2,30,31)(H,32,35)(H,33,37)/t19-,21+,22?/m1/s1 |
| InChIKey | MLBGTAROAHPMLC-DOYJUQJDSA-N |
| XLogP | 3.90 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |