C29H31N8O2+ — CID 139580986
N-(3-amino-5H-pyrrolo[2,3-b]pyrazin-2-yl)-N-[[1-benzyl-3-(2-oxo-2-piperidin-1-ylethyl)benzimidazol-1-ium-2-yl]methyl]formamide (PubChem CID 139580986) has the molecular formula C29H31N8O2+ and a molecular weight of 523.62 g/mol. Its IUPAC name is N-(3-amino-5H-pyrrolo[2,3-b]pyrazin-2-yl)-N-[[1-benzyl-3-(2-oxo-2-piperidin-1-ylethyl)benzimidazol-1-ium-2-yl]methyl]formamide.
| Compound Name | N-(3-amino-5H-pyrrolo[2,3-b]pyrazin-2-yl)-N-[[1-benzyl-3-(2-oxo-2-piperidin-1-ylethyl)benzimidazol-1-ium-2-yl]methyl]formamide |
|---|---|
| PubChem CID | 139580986 |
| Molecular Formula | C29H31N8O2+ |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | N-(3-amino-5H-pyrrolo[2,3-b]pyrazin-2-yl)-N-[[1-benzyl-3-(2-oxo-2-piperidin-1-ylethyl)benzimidazol-1-ium-2-yl]methyl]formamide |
| SMILES | Nc1nc2[nH]ccc2nc1N(C=O)Cc1n(CC(=O)N2CCCCC2)c2ccccc2[n+]1Cc1ccccc1 |
| InChI | InChI=1S/C29H31N8O2/c30-27-29(32-22-13-14-31-28(22)33-27)35(20-38)18-25-36(17-21-9-3-1-4-10-21)23-11-5-6-12-24(23)37(25)19-26(39)34-15-7-2-8-16-34/h1,3-6,9-14,20H,2,7-8,15-19H2,(H3,30,31,33)/q+1 |
| InChIKey | QLPARDTUCIDXPV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|