C27H25N7O2 — CID 139581775
4-[8-amino-3-[(1R,3S,4S)-2-prop-2-enoyl-2-azabicyclo[2.2.1]heptan-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide (PubChem CID 139581775) has the molecular formula C27H25N7O2 and a molecular weight of 479.54 g/mol. Its IUPAC name is 4-[8-amino-3-[(1R,3S,4S)-2-prop-2-enoyl-2-azabicyclo[2.2.1]heptan-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[8-amino-3-[(1R,3S,4S)-2-prop-2-enoyl-2-azabicyclo[2.2.1]heptan-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 139581775 |
| Molecular Formula | C27H25N7O2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 4-[8-amino-3-[(1R,3S,4S)-2-prop-2-enoyl-2-azabicyclo[2.2.1]heptan-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
| SMILES | C=CC(=O)N1[C@@H]2CC[C@@H](C2)[C@H]1c1nc(-c2ccc(C(=O)Nc3ccccn3)cc2)c2c(N)nccn12 |
| InChI | InChI=1S/C27H25N7O2/c1-2-21(35)34-19-11-10-18(15-19)23(34)26-32-22(24-25(28)30-13-14-33(24)26)16-6-8-17(9-7-16)27(36)31-20-5-3-4-12-29-20/h2-9,12-14,18-19,23H,1,10-11,15H2,(H2,28,30)(H,29,31,36)/t18-,19+,23-/m0/s1 |
| InChIKey | VSZPBQSEJAPADZ-YYDVJCTNSA-N |
| XLogP | 3.86 |
| TPSA | 118.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|