C29H29N7O2 — CID 146177281
4-[8-amino-3-[(2S,5R)-1,6,6-trimethyl-3-prop-2-enoyl-3-azabicyclo[3.1.0]hexan-2-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide (PubChem CID 146177281) has the molecular formula C29H29N7O2 and a molecular weight of 507.60 g/mol. Its IUPAC name is 4-[8-amino-3-[(2S,5R)-1,6,6-trimethyl-3-prop-2-enoyl-3-azabicyclo[3.1.0]hexan-2-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[8-amino-3-[(2S,5R)-1,6,6-trimethyl-3-prop-2-enoyl-3-azabicyclo[3.1.0]hexan-2-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 146177281 |
| Molecular Formula | C29H29N7O2 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 4-[8-amino-3-[(2S,5R)-1,6,6-trimethyl-3-prop-2-enoyl-3-azabicyclo[3.1.0]hexan-2-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
| SMILES | C=CC(=O)N1C[C@@H]2C(C)(C)C2(C)[C@H]1c1nc(-c2ccc(C(=O)Nc3ccccn3)cc2)c2c(N)nccn12 |
| InChI | InChI=1S/C29H29N7O2/c1-5-21(37)36-16-19-28(2,3)29(19,4)24(36)26-34-22(23-25(30)32-14-15-35(23)26)17-9-11-18(12-10-17)27(38)33-20-8-6-7-13-31-20/h5-15,19,24H,1,16H2,2-4H3,(H2,30,32)(H,31,33,38)/t19-,24-,29?/m1/s1 |
| InChIKey | NPLGYOGHUHQMEA-FRUHDXNPSA-N |
| XLogP | 4.36 |
| TPSA | 118.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|