C19H13Cl2FN4O — CID 139582371
2-(dichloromethyl)-7-(4-fluorophenyl)-4-(4-methoxyphenyl)pyrazolo[1,5-a][1,3,5]triazine (PubChem CID 139582371) has the molecular formula C19H13Cl2FN4O and a molecular weight of 403.24 g/mol. Its IUPAC name is 2-(dichloromethyl)-7-(4-fluorophenyl)-4-(4-methoxyphenyl)pyrazolo[1,5-a][1,3,5]triazine.
| Compound Name | 2-(dichloromethyl)-7-(4-fluorophenyl)-4-(4-methoxyphenyl)pyrazolo[1,5-a][1,3,5]triazine |
|---|---|
| PubChem CID | 139582371 |
| Molecular Formula | C19H13Cl2FN4O |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2-(dichloromethyl)-7-(4-fluorophenyl)-4-(4-methoxyphenyl)pyrazolo[1,5-a][1,3,5]triazine |
| SMILES | COc1ccc(-c2nc(C(Cl)Cl)nc3cc(-c4ccc(F)cc4)nn23)cc1 |
| InChI | InChI=1S/C19H13Cl2FN4O/c1-27-14-8-4-12(5-9-14)19-24-18(17(20)21)23-16-10-15(25-26(16)19)11-2-6-13(22)7-3-11/h2-10,17H,1H3 |
| InChIKey | FGIYNTKKRDVHGF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|