C16H9Cl2FN4O — CID 139582726
2-(dichloromethyl)-7-(4-fluorophenyl)-4-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazine (PubChem CID 139582726) has the molecular formula C16H9Cl2FN4O and a molecular weight of 363.18 g/mol. Its IUPAC name is 2-(dichloromethyl)-7-(4-fluorophenyl)-4-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazine.
| Compound Name | 2-(dichloromethyl)-7-(4-fluorophenyl)-4-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazine |
|---|---|
| PubChem CID | 139582726 |
| Molecular Formula | C16H9Cl2FN4O |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-(dichloromethyl)-7-(4-fluorophenyl)-4-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazine |
| SMILES | Fc1ccc(-c2cc3nc(C(Cl)Cl)nc(-c4ccco4)n3n2)cc1 |
| InChI | InChI=1S/C16H9Cl2FN4O/c17-14(18)15-20-13-8-11(9-3-5-10(19)6-4-9)22-23(13)16(21-15)12-2-1-7-24-12/h1-8,14H |
| InChIKey | ZMULWKVMNSDYJB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|