C17H11FN2O — CID 15530901
2-(4-fluorophenyl)-6-(furan-2-yl)imidazo[1,2-a]pyridine (PubChem CID 15530901) has the molecular formula C17H11FN2O and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-(furan-2-yl)imidazo[1,2-a]pyridine.
| Compound Name | 2-(4-fluorophenyl)-6-(furan-2-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 15530901 |
| Molecular Formula | C17H11FN2O |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-(4-fluorophenyl)-6-(furan-2-yl)imidazo[1,2-a]pyridine |
| SMILES | Fc1ccc(-c2cn3cc(-c4ccco4)ccc3n2)cc1 |
| InChI | InChI=1S/C17H11FN2O/c18-14-6-3-12(4-7-14)15-11-20-10-13(5-8-17(20)19-15)16-2-1-9-21-16/h1-11H |
| InChIKey | DPSFOVNBNNAZAQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |