C18H13FN4 — CID 177316308
3-[6-(4-fluorophenyl)imidazo[1,2-a]pyridin-2-yl]pyridin-2-amine (PubChem CID 177316308) has the molecular formula C18H13FN4 and a molecular weight of 304.33 g/mol. Its IUPAC name is 3-[6-(4-fluorophenyl)imidazo[1,2-a]pyridin-2-yl]pyridin-2-amine.
| Compound Name | 3-[6-(4-fluorophenyl)imidazo[1,2-a]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 177316308 |
| Molecular Formula | C18H13FN4 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3-[6-(4-fluorophenyl)imidazo[1,2-a]pyridin-2-yl]pyridin-2-amine |
| SMILES | Nc1ncccc1-c1cn2cc(-c3ccc(F)cc3)ccc2n1 |
| InChI | InChI=1S/C18H13FN4/c19-14-6-3-12(4-7-14)13-5-8-17-22-16(11-23(17)10-13)15-2-1-9-21-18(15)20/h1-11H,(H2,20,21) |
| InChIKey | VZHFZUUAPWPVNP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |