C30H30Cl2FN3 — CID 177316474
3-[1-chloro-3-[4-(chloromethyl)phenyl]-6-(4-fluorophenyl)indolizin-2-yl]pyridin-2-amine;ethane (PubChem CID 177316474) has the molecular formula C30H30Cl2FN3 and a molecular weight of 522.50 g/mol. Its IUPAC name is 3-[1-chloro-3-[4-(chloromethyl)phenyl]-6-(4-fluorophenyl)indolizin-2-yl]pyridin-2-amine;ethane.
| Compound Name | 3-[1-chloro-3-[4-(chloromethyl)phenyl]-6-(4-fluorophenyl)indolizin-2-yl]pyridin-2-amine;ethane |
|---|---|
| PubChem CID | 177316474 |
| Molecular Formula | C30H30Cl2FN3 |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 3-[1-chloro-3-[4-(chloromethyl)phenyl]-6-(4-fluorophenyl)indolizin-2-yl]pyridin-2-amine;ethane |
| SMILES | CC.CC.Nc1ncccc1-c1c(Cl)c2ccc(-c3ccc(F)cc3)cn2c1-c1ccc(CCl)cc1 |
| InChI | InChI=1S/C26H18Cl2FN3.2C2H6/c27-14-16-3-5-18(6-4-16)25-23(21-2-1-13-31-26(21)30)24(28)22-12-9-19(15-32(22)25)17-7-10-20(29)11-8-17;2*1-2/h1-13,15H,14H2,(H2,30,31);2*1-2H3 |
| InChIKey | FENUAJWJMKZPKF-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|