C23H16ClFN6 — CID 177317077
3-[3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)imidazo[4,5-b]pyrazin-2-yl]pyridin-2-amine (PubChem CID 177317077) has the molecular formula C23H16ClFN6 and a molecular weight of 430.87 g/mol. Its IUPAC name is 3-[3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)imidazo[4,5-b]pyrazin-2-yl]pyridin-2-amine.
| Compound Name | 3-[3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)imidazo[4,5-b]pyrazin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 177317077 |
| Molecular Formula | C23H16ClFN6 |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 3-[3-[4-(chloromethyl)phenyl]-5-(4-fluorophenyl)imidazo[4,5-b]pyrazin-2-yl]pyridin-2-amine |
| SMILES | Nc1ncccc1-c1nc2ncc(-c3ccc(F)cc3)nc2n1-c1ccc(CCl)cc1 |
| InChI | InChI=1S/C23H16ClFN6/c24-12-14-3-9-17(10-4-14)31-22(18-2-1-11-27-20(18)26)30-21-23(31)29-19(13-28-21)15-5-7-16(25)8-6-15/h1-11,13H,12H2,(H2,26,27) |
| InChIKey | GPCIZVZCMGMZNT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|