C18H12FIN4 — CID 177316140
3-[3-(4-fluorophenyl)-8-iodopyrrolo[1,2-a]pyrazin-7-yl]pyridin-2-amine (PubChem CID 177316140) has the molecular formula C18H12FIN4 and a molecular weight of 430.22 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)-8-iodopyrrolo[1,2-a]pyrazin-7-yl]pyridin-2-amine.
| Compound Name | 3-[3-(4-fluorophenyl)-8-iodopyrrolo[1,2-a]pyrazin-7-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 177316140 |
| Molecular Formula | C18H12FIN4 |
| Molecular Weight | 430.22 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 3-[3-(4-fluorophenyl)-8-iodopyrrolo[1,2-a]pyrazin-7-yl]pyridin-2-amine |
| SMILES | Nc1ncccc1-c1cn2cc(-c3ccc(F)cc3)ncc2c1I |
| InChI | InChI=1S/C18H12FIN4/c19-12-5-3-11(4-6-12)15-10-24-9-14(17(20)16(24)8-23-15)13-2-1-7-22-18(13)21/h1-10H,(H2,21,22) |
| InChIKey | HZWMNOUYVGNWLW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|