C16H11FN4OS — CID 66624247
[4-[2-(2-fluoro-3-pyridinyl)imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol (PubChem CID 66624247) has the molecular formula C16H11FN4OS and a molecular weight of 326.36 g/mol. Its IUPAC name is [4-[2-(2-fluoro-3-pyridinyl)imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol.
| Compound Name | [4-[2-(2-fluoro-3-pyridinyl)imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol |
|---|---|
| PubChem CID | 66624247 |
| Molecular Formula | C16H11FN4OS |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | [4-[2-(2-fluoro-3-pyridinyl)imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-2-yl]methanol |
| SMILES | OCc1nc(-c2ccc3nc(-c4cccnc4F)cn3c2)cs1 |
| InChI | InChI=1S/C16H11FN4OS/c17-16-11(2-1-5-18-16)12-7-21-6-10(3-4-14(21)19-12)13-9-23-15(8-22)20-13/h1-7,9,22H,8H2 |
| InChIKey | LMRLKQXGHLPJAT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|