C10H9NO2S — CID 105460333
2-[2-(hydroxymethyl)-1,3-thiazol-4-yl]phenol (PubChem CID 105460333) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-1,3-thiazol-4-yl]phenol.
| Compound Name | 2-[2-(hydroxymethyl)-1,3-thiazol-4-yl]phenol |
|---|---|
| PubChem CID | 105460333 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 2-[2-(hydroxymethyl)-1,3-thiazol-4-yl]phenol |
| SMILES | OCc1nc(-c2ccccc2O)cs1 |
| InChI | InChI=1S/C10H9NO2S/c12-5-10-11-8(6-14-10)7-3-1-2-4-9(7)13/h1-4,6,12-13H,5H2 |
| InChIKey | SYFHCIATXQBHBT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |