C11H9F2NO2S — CID 55157591
[4-[2-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]methanol (PubChem CID 55157591) has the molecular formula C11H9F2NO2S and a molecular weight of 257.26 g/mol. Its IUPAC name is [4-[2-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]methanol.
| Compound Name | [4-[2-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]methanol |
|---|---|
| PubChem CID | 55157591 |
| Molecular Formula | C11H9F2NO2S |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | [4-[2-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]methanol |
| SMILES | OCc1nc(-c2ccccc2OC(F)F)cs1 |
| InChI | InChI=1S/C11H9F2NO2S/c12-11(13)16-9-4-2-1-3-7(9)8-6-17-10(5-15)14-8/h1-4,6,11,15H,5H2 |
| InChIKey | PACQMPGMYFPWNS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |