C11H9F2NO3 — CID 178133095
[3-[2-(difluoromethoxy)phenyl]-1,2-oxazol-5-yl]methanol (PubChem CID 178133095) has the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. Its IUPAC name is [3-[2-(difluoromethoxy)phenyl]-1,2-oxazol-5-yl]methanol.
| Compound Name | [3-[2-(difluoromethoxy)phenyl]-1,2-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 178133095 |
| Molecular Formula | C11H9F2NO3 |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | [3-[2-(difluoromethoxy)phenyl]-1,2-oxazol-5-yl]methanol |
| SMILES | OCc1cc(-c2ccccc2OC(F)F)no1 |
| InChI | InChI=1S/C11H9F2NO3/c12-11(13)16-10-4-2-1-3-8(10)9-5-7(6-15)17-14-9/h1-5,11,15H,6H2 |
| InChIKey | HIQVXOSVKNLGPD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |