C15H17NO3 — CID 169196805
[3-[2-methoxy-5-(2-methylprop-2-enyl)phenyl]-1,2-oxazol-5-yl]methanol (PubChem CID 169196805) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is [3-[2-methoxy-5-(2-methylprop-2-enyl)phenyl]-1,2-oxazol-5-yl]methanol.
| Compound Name | [3-[2-methoxy-5-(2-methylprop-2-enyl)phenyl]-1,2-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 169196805 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | [3-[2-methoxy-5-(2-methylprop-2-enyl)phenyl]-1,2-oxazol-5-yl]methanol |
| SMILES | C=C(C)Cc1ccc(OC)c(-c2cc(CO)on2)c1 |
| InChI | InChI=1S/C15H17NO3/c1-10(2)6-11-4-5-15(18-3)13(7-11)14-8-12(9-17)19-16-14/h4-5,7-8,17H,1,6,9H2,2-3H3 |
| InChIKey | BRBFCXOKELGWKS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|