C18H25N3O2 — CID 169196786
3-(2-methoxy-5-propylphenyl)-5-(piperazin-1-ylmethyl)-1,2-oxazole (PubChem CID 169196786) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-(2-methoxy-5-propylphenyl)-5-(piperazin-1-ylmethyl)-1,2-oxazole.
| Compound Name | 3-(2-methoxy-5-propylphenyl)-5-(piperazin-1-ylmethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 169196786 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 3-(2-methoxy-5-propylphenyl)-5-(piperazin-1-ylmethyl)-1,2-oxazole |
| SMILES | CCCc1ccc(OC)c(-c2cc(CN3CCNCC3)on2)c1 |
| InChI | InChI=1S/C18H25N3O2/c1-3-4-14-5-6-18(22-2)16(11-14)17-12-15(23-20-17)13-21-9-7-19-8-10-21/h5-6,11-12,19H,3-4,7-10,13H2,1-2H3 |
| InChIKey | ALNRLNIUCBEMDH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |