C21H21NO3 — CID 155528342
3-(2-methoxy-5-prop-2-enylphenyl)-5-(phenylmethoxymethyl)-1,2-oxazole (PubChem CID 155528342) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 3-(2-methoxy-5-prop-2-enylphenyl)-5-(phenylmethoxymethyl)-1,2-oxazole.
| Compound Name | 3-(2-methoxy-5-prop-2-enylphenyl)-5-(phenylmethoxymethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 155528342 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-(2-methoxy-5-prop-2-enylphenyl)-5-(phenylmethoxymethyl)-1,2-oxazole |
| SMILES | C=CCc1ccc(OC)c(-c2cc(COCc3ccccc3)on2)c1 |
| InChI | InChI=1S/C21H21NO3/c1-3-7-16-10-11-21(23-2)19(12-16)20-13-18(25-22-20)15-24-14-17-8-5-4-6-9-17/h3-6,8-13H,1,7,14-15H2,2H3 |
| InChIKey | XVYRNMYGUYNGKS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|