C17H14N4OS — CID 71517746
2-ethylsulfanyl-4-(furan-2-yl)-7-phenylpyrazolo[1,5-a][1,3,5]triazine (PubChem CID 71517746) has the molecular formula C17H14N4OS and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-ethylsulfanyl-4-(furan-2-yl)-7-phenylpyrazolo[1,5-a][1,3,5]triazine.
| Compound Name | 2-ethylsulfanyl-4-(furan-2-yl)-7-phenylpyrazolo[1,5-a][1,3,5]triazine |
|---|---|
| PubChem CID | 71517746 |
| Molecular Formula | C17H14N4OS |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-ethylsulfanyl-4-(furan-2-yl)-7-phenylpyrazolo[1,5-a][1,3,5]triazine |
| SMILES | CCSc1nc(-c2ccco2)n2nc(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C17H14N4OS/c1-2-23-17-18-15-11-13(12-7-4-3-5-8-12)20-21(15)16(19-17)14-9-6-10-22-14/h3-11H,2H2,1H3 |
| InChIKey | GOIJYBDXLXUJHL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_pyridine_A(1)', 'substructure': 'N/A'} |
|---|