C34H52O12S2 — CID 139584271
11-(3,5-disulfooxyphenyl)undecan-4-yl 2-decyl-4,6-dihydroxybenzoate (PubChem CID 139584271) has the molecular formula C34H52O12S2 and a molecular weight of 716.91 g/mol. Its IUPAC name is 11-(3,5-disulfooxyphenyl)undecan-4-yl 2-decyl-4,6-dihydroxybenzoate.
| Compound Name | 11-(3,5-disulfooxyphenyl)undecan-4-yl 2-decyl-4,6-dihydroxybenzoate |
|---|---|
| PubChem CID | 139584271 |
| Molecular Formula | C34H52O12S2 |
| Molecular Weight | 716.91 g/mol |
| Exact Mass | 716.29 |
| IUPAC Name | 11-(3,5-disulfooxyphenyl)undecan-4-yl 2-decyl-4,6-dihydroxybenzoate |
| SMILES | CCCCCCCCCCc1cc(O)cc(O)c1C(=O)OC(CCC)CCCCCCCc1cc(OS(=O)(=O)O)cc(OS(=O)(=O)O)c1 |
| InChI | InChI=1S/C34H52O12S2/c1-3-5-6-7-8-9-12-15-19-27-23-28(35)24-32(36)33(27)34(37)44-29(17-4-2)20-16-13-10-11-14-18-26-21-30(45-47(38,39)40)25-31(22-26)46-48(41,42)43/h21-25,29,35-36H,3-20H2,1-2H3,(H,38,39,40)(H,41,42,43) |
| InChIKey | ZXOKOJPNQMQCSF-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 193.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.91 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|