C21H36O5S — CID 162816604
[3-hydroxy-5-[(11R)-11-methyltetradecyl]phenyl] hydrogen sulfate (PubChem CID 162816604) has the molecular formula C21H36O5S and a molecular weight of 400.58 g/mol. Its IUPAC name is [3-hydroxy-5-[(11R)-11-methyltetradecyl]phenyl] hydrogen sulfate.
| Compound Name | [3-hydroxy-5-[(11R)-11-methyltetradecyl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 162816604 |
| Molecular Formula | C21H36O5S |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | [3-hydroxy-5-[(11R)-11-methyltetradecyl]phenyl] hydrogen sulfate |
| SMILES | CCC[C@@H](C)CCCCCCCCCCc1cc(O)cc(OS(=O)(=O)O)c1 |
| InChI | InChI=1S/C21H36O5S/c1-3-12-18(2)13-10-8-6-4-5-7-9-11-14-19-15-20(22)17-21(16-19)26-27(23,24)25/h15-18,22H,3-14H2,1-2H3,(H,23,24,25)/t18-/m1/s1 |
| InChIKey | DTKXGPUQRVDFCG-GOSISDBHSA-N |
| XLogP | 6.06 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|