C16H26O3 — CID 139588090
1-[(1S,2S,4aR,6S,8aS)-6-hydroxy-1,2,6-trimethyl-2,4a,5,7,8,8a-hexahydronaphthalen-1-yl]-3-hydroxypropan-1-one (PubChem CID 139588090) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-[(1S,2S,4aR,6S,8aS)-6-hydroxy-1,2,6-trimethyl-2,4a,5,7,8,8a-hexahydronaphthalen-1-yl]-3-hydroxypropan-1-one.
| Compound Name | 1-[(1S,2S,4aR,6S,8aS)-6-hydroxy-1,2,6-trimethyl-2,4a,5,7,8,8a-hexahydronaphthalen-1-yl]-3-hydroxypropan-1-one |
|---|---|
| PubChem CID | 139588090 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1-[(1S,2S,4aR,6S,8aS)-6-hydroxy-1,2,6-trimethyl-2,4a,5,7,8,8a-hexahydronaphthalen-1-yl]-3-hydroxypropan-1-one |
| SMILES | C[C@H]1C=C[C@H]2C[C@@](C)(O)CC[C@@H]2[C@@]1(C)C(=O)CCO |
| InChI | InChI=1S/C16H26O3/c1-11-4-5-12-10-15(2,19)8-6-13(12)16(11,3)14(18)7-9-17/h4-5,11-13,17,19H,6-10H2,1-3H3/t11-,12-,13-,15-,16-/m0/s1 |
| InChIKey | LUIMBFWYYYLNKF-IICXDKKESA-N |
| XLogP | 2.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|